CAS 1290629-45-6 is the registry number for CRT0066101 (hydrochloride). Offered by: GLPBio. Available pack sizes: 1mg, 10mg, 5mg.
2-[4-[[(2R)-2-aminobutyl]amino]pyrimidin-2-yl]-4-(1-methylpyrazol-4-yl)phenol;hydrochloride (CAS 1290629-45-6) is a chemical compound with the molecular formula C18H23ClN6O and a molecular weight of 374.9 g/mol. IUPAC name: 2-[4-[[(2R)-2-aminobutyl]amino]pyrimidin-2-yl]-4-(1-methylpyrazol-4-yl)phenol;hydrochloride. InChIKey: NBKRZGHHBBHLOQ-PFEQFJNWSA-N.
| Molecular formula | C18H23ClN6O |
|---|---|
| Molecular weight | 374.9 g/mol |
| IUPAC name | 2-[4-[[(2R)-2-aminobutyl]amino]pyrimidin-2-yl]-4-(1-methylpyrazol-4-yl)phenol;hydrochloride |
| InChIKey | NBKRZGHHBBHLOQ-PFEQFJNWSA-N |
| SMILES | CC[C@H](CNC1=NC(=NC=C1)C2=C(C=CC(=C2)C3=CN(N=C3)C)O)N.Cl |
Computed by PubChem (NCBI)