CAS 129073-86-5 is the registry number for 1,3-Dimethoxy-1,3-dimethyl-1,3-diphenyldisiloxane, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Methoxy-(methoxy-methyl-phenylsilyl)oxy-methyl-phenylsilane (CAS 129073-86-5) is a chemical compound with the molecular formula C16H22O3Si2 and a molecular weight of 318.51 g/mol. IUPAC name: methoxy-(methoxy-methyl-phenylsilyl)oxy-methyl-phenylsilane. InChIKey: VGKWMZBSFWXDHX-UHFFFAOYSA-N.
| Molecular formula | C16H22O3Si2 |
|---|---|
| Molecular weight | 318.51 g/mol |
| IUPAC name | methoxy-(methoxy-methyl-phenylsilyl)oxy-methyl-phenylsilane |
| InChIKey | VGKWMZBSFWXDHX-UHFFFAOYSA-N |
| SMILES | CO[Si](C)(C1=CC=CC=C1)O[Si](C)(C2=CC=CC=C2)OC |
Computed by PubChem (NCBI)