Products 1290737-81-3

CAS 1290737-81-3 is the registry number for 5-Ethyl-4-iodo-1h-pyrazole-3-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

5-ethyl-4-iodo-1H-pyrazole-3-carboxylic acid (CAS 1290737-81-3) is a chemical compound with the molecular formula C6H7IN2O2 and a molecular weight of 266.04 g/mol. IUPAC name: 5-ethyl-4-iodo-1H-pyrazole-3-carboxylic acid. InChIKey: KNKYAMVSGZNPIE-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7IN2O2
Molecular weight266.04 g/mol
IUPAC name5-ethyl-4-iodo-1H-pyrazole-3-carboxylic acid
InChIKeyKNKYAMVSGZNPIE-UHFFFAOYSA-N
SMILESCCC1=C(C(=NN1)C(=O)O)I

Computed by PubChem (NCBI)