CAS 129095-08-5 is the registry number for sodium,2-(5,6-dimethyl-9-oxoxanthen-4-yl)acetate. Offered by: Chemat. Available pack sizes: 10mg, 50mg.
Sodium 2-(5,6-dimethyl-9-oxoxanthen-4-yl)acetate (CAS 129095-08-5) is a chemical compound with the molecular formula C17H13NaO4 and a molecular weight of 304.27 g/mol. IUPAC name: sodium 2-(5,6-dimethyl-9-oxoxanthen-4-yl)acetate. InChIKey: CUHSZPRXKQDLCJ-UHFFFAOYSA-M.
| Molecular formula | C17H13NaO4 |
|---|---|
| Molecular weight | 304.27 g/mol |
| IUPAC name | sodium 2-(5,6-dimethyl-9-oxoxanthen-4-yl)acetate |
| InChIKey | CUHSZPRXKQDLCJ-UHFFFAOYSA-M |
| SMILES | CC1=C(C2=C(C=C1)C(=O)C3=CC=CC(=C3O2)CC(=O)[O-])C.[Na+] |
Computed by PubChem (NCBI)