CAS 1291088-77-1 is the registry number for NH2–MIL–53(Fe). Offered by: GLPBio. Available pack sizes: 1g.
2-aminoterephthalate;iron(3+);hydroxide (CAS 1291088-77-1) is a chemical compound with the molecular formula C8H6FeNO5 and a molecular weight of 251.98 g/mol. IUPAC name: 2-aminoterephthalate;iron(3+);hydroxide. InChIKey: IOCNCYBKRUIJCA-UHFFFAOYSA-K.
| Molecular formula | C8H6FeNO5 |
|---|---|
| Molecular weight | 251.98 g/mol |
| IUPAC name | 2-aminoterephthalate;iron(3+);hydroxide |
| InChIKey | IOCNCYBKRUIJCA-UHFFFAOYSA-K |
| SMILES | C1=CC(=C(C=C1C(=O)[O-])N)C(=O)[O-].[OH-].[Fe+3] |
Computed by PubChem (NCBI)