CAS 1291094-65-9 is the registry number for 6-(2-Bromo-5-iodobenzyl)-2,3-dihydrobenzo[b][1,4]dioxine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-[(2-bromo-5-iodophenyl)methyl]-2,3-dihydro-1,4-benzodioxine (CAS 1291094-65-9) is a chemical compound with the molecular formula C15H12BrIO2 and a molecular weight of 431.06 g/mol. IUPAC name: 6-[(2-bromo-5-iodophenyl)methyl]-2,3-dihydro-1,4-benzodioxine. InChIKey: PNHUJQOGRWCBCR-UHFFFAOYSA-N.
| Molecular formula | C15H12BrIO2 |
|---|---|
| Molecular weight | 431.06 g/mol |
| IUPAC name | 6-[(2-bromo-5-iodophenyl)methyl]-2,3-dihydro-1,4-benzodioxine |
| InChIKey | PNHUJQOGRWCBCR-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)CC3=C(C=CC(=C3)I)Br |
Computed by PubChem (NCBI)