CAS 129115-89-5 appears in our catalog under these names: ((2R,3R,4R,5S)-3,4-bis(benzyloxy)tetrahydrofuran-2,5-diyl)dimethanol, 98%, 2,5-Anhydro-3,4-dibenzyl-D-glucitol. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 5mg, 50mg, 100mg.
[(2S,3R,4R,5R)-5-(hydroxymethyl)-3,4-bis(phenylmethoxy)oxolan-2-yl]methanol (CAS 129115-89-5) is a chemical compound with the molecular formula C20H24O5 and a molecular weight of 344.4 g/mol. IUPAC name: [(2S,3R,4R,5R)-5-(hydroxymethyl)-3,4-bis(phenylmethoxy)oxolan-2-yl]methanol. InChIKey: GCCFBDFJFARWGD-IYWMVGAKSA-N.
| Molecular formula | C20H24O5 |
|---|---|
| Molecular weight | 344.4 g/mol |
| IUPAC name | [(2S,3R,4R,5R)-5-(hydroxymethyl)-3,4-bis(phenylmethoxy)oxolan-2-yl]methanol |
| InChIKey | GCCFBDFJFARWGD-IYWMVGAKSA-N |
| SMILES | C1=CC=C(C=C1)CO[C@@H]2[C@H](O[C@H]([C@H]2OCC3=CC=CC=C3)CO)CO |
Computed by PubChem (NCBI)