Products 1291486-24-2

CAS 1291486-24-2 is the registry number for 1-Methyl-5-oxopyrrolidine-3-carbonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-methyl-5-oxopyrrolidine-3-carbonyl chloride (CAS 1291486-24-2) is a chemical compound with the molecular formula C6H8ClNO2 and a molecular weight of 161.58 g/mol. IUPAC name: 1-methyl-5-oxopyrrolidine-3-carbonyl chloride. InChIKey: HPNQOUDCVFXCEP-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8ClNO2
Molecular weight161.58 g/mol
IUPAC name1-methyl-5-oxopyrrolidine-3-carbonyl chloride
InChIKeyHPNQOUDCVFXCEP-UHFFFAOYSA-N
SMILESCN1CC(CC1=O)C(=O)Cl

Computed by PubChem (NCBI)