Products 1291488-79-3

CAS 1291488-79-3 is the registry number for (4-Chlorosulfonyl-2-fluoro-phenoxy)-acetic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 2-(4-chlorosulfonyl-2-fluorophenoxy)acetate (CAS 1291488-79-3) is a chemical compound with the molecular formula C9H8ClFO5S and a molecular weight of 282.67 g/mol. IUPAC name: methyl 2-(4-chlorosulfonyl-2-fluorophenoxy)acetate. InChIKey: ALKOTPGYOXHJTJ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8ClFO5S
Molecular weight282.67 g/mol
IUPAC namemethyl 2-(4-chlorosulfonyl-2-fluorophenoxy)acetate
InChIKeyALKOTPGYOXHJTJ-UHFFFAOYSA-N
SMILESCOC(=O)COC1=C(C=C(C=C1)S(=O)(=O)Cl)F

Computed by PubChem (NCBI)