CAS 129165-82-8 appears in our catalog under these names: 1,3-Bis(6-benzoyl-1H-benzo[d]imidazol-2-yl)urea, 98%, Mebendazole EP Impurity G, MEBENDAZOLE DIMER. Offered by: Chemat Brand, Sigma-Aldrich. Available pack sizes: on request, 25MG.
1,3-bis(6-benzoyl-1H-benzimidazol-2-yl)urea (CAS 129165-82-8) is a chemical compound with the molecular formula C29H20N6O3 and a molecular weight of 500.5 g/mol. IUPAC name: 1,3-bis(6-benzoyl-1H-benzimidazol-2-yl)urea. InChIKey: NCJRIAUJDRRABM-UHFFFAOYSA-N.
| Molecular formula | C29H20N6O3 |
|---|---|
| Molecular weight | 500.5 g/mol |
| IUPAC name | 1,3-bis(6-benzoyl-1H-benzimidazol-2-yl)urea |
| InChIKey | NCJRIAUJDRRABM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC3=C(C=C2)N=C(N3)NC(=O)NC4=NC5=C(N4)C=C(C=C5)C(=O)C6=CC=CC=C6 |
Computed by PubChem (NCBI)