CAS 129181-43-7 is the registry number for tert–butyldimethyl(4–(prop–1–en–2–yl)phenoxy)silane. Offered by: GLPBio. Available pack sizes: 1g, 5g.
Tert-butyl-dimethyl-(4-prop-1-en-2-ylphenoxy)silane (CAS 129181-43-7) is a chemical compound with the molecular formula C15H24OSi and a molecular weight of 248.43 g/mol. IUPAC name: tert-butyl-dimethyl-(4-prop-1-en-2-ylphenoxy)silane. InChIKey: GANAAUIATAGRLR-UHFFFAOYSA-N.
| Molecular formula | C15H24OSi |
|---|---|
| Molecular weight | 248.43 g/mol |
| IUPAC name | tert-butyl-dimethyl-(4-prop-1-en-2-ylphenoxy)silane |
| InChIKey | GANAAUIATAGRLR-UHFFFAOYSA-N |
| SMILES | CC(=C)C1=CC=C(C=C1)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)