CAS 1291836-98-0 is the registry number for 6-(Thiomorpholin-4-ylsulfonyl)[1,2,4]triazolo[4,3-a]pyridin-3(2h)-one, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
6-thiomorpholin-4-ylsulfonyl-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one (CAS 1291836-98-0) is a chemical compound with the molecular formula C10H12N4O3S2 and a molecular weight of 300.4 g/mol. IUPAC name: 6-thiomorpholin-4-ylsulfonyl-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one. InChIKey: ZBRWETWWGPWSST-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O3S2 |
|---|---|
| Molecular weight | 300.4 g/mol |
| IUPAC name | 6-thiomorpholin-4-ylsulfonyl-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| InChIKey | ZBRWETWWGPWSST-UHFFFAOYSA-N |
| SMILES | C1CSCCN1S(=O)(=O)C2=CN3C(=NNC3=O)C=C2 |
Computed by PubChem (NCBI)