Products 1291916-17-0

CAS 1291916-17-0 is the registry number for Flumazenil Impurity 7. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(2-amino-5-fluorobenzoyl)amino]-5-fluorobenzoic acid (CAS 1291916-17-0) is a chemical compound with the molecular formula C14H10F2N2O3 and a molecular weight of 292.24 g/mol. IUPAC name: 2-[(2-amino-5-fluorobenzoyl)amino]-5-fluorobenzoic acid. InChIKey: PFHOQWHCZUOPJI-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10F2N2O3
Molecular weight292.24 g/mol
IUPAC name2-[(2-amino-5-fluorobenzoyl)amino]-5-fluorobenzoic acid
InChIKeyPFHOQWHCZUOPJI-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1F)C(=O)NC2=C(C=C(C=C2)F)C(=O)O)N

Computed by PubChem (NCBI)