CAS 129200-10-8 appears in our catalog under these names: KB-5492 anhydrous, 98%, KB-5492 anhydrous, KB–5492 anhydrous, 1-(3,4,5-Trimethoxybenzyl)-4-((4-methoxyphenyl)oxycarbonylmethyl)piperazine, KB-5492 (anhydrous), 99.50%, 99.50%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 5mg, 1mg, 25mg, 50mg, 100mg, 10mg, 100 mg, 10mM/1mL.
(E)-but-2-enedioic acid;(4-methoxyphenyl) 2-[4-[(3,4,5-trimethoxyphenyl)methyl]piperazin-1-yl]acetate (CAS 129200-10-8) is a chemical compound with the molecular formula C27H34N2O10 and a molecular weight of 546.6 g/mol. IUPAC name: (E)-but-2-enedioic acid;(4-methoxyphenyl) 2-[4-[(3,4,5-trimethoxyphenyl)methyl]piperazin-1-yl]acetate. InChIKey: JUOYRBCKLAPYBI-WLHGVMLRSA-N.
| Molecular formula | C27H34N2O10 |
|---|---|
| Molecular weight | 546.6 g/mol |
| IUPAC name | (E)-but-2-enedioic acid;(4-methoxyphenyl) 2-[4-[(3,4,5-trimethoxyphenyl)methyl]piperazin-1-yl]acetate |
| InChIKey | JUOYRBCKLAPYBI-WLHGVMLRSA-N |
| SMILES | COC1=CC=C(C=C1)OC(=O)CN2CCN(CC2)CC3=CC(=C(C(=C3)OC)OC)OC.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)