Products 1292238-13-1

CAS 1292238-13-1 is the registry number for 3-(5-Methyl-1H-1,2,3,4-tetrazol-1-yl)-5-(trifluoromethyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-(5-methyltetrazol-1-yl)-5-(trifluoromethyl)benzoic acid (CAS 1292238-13-1) is a chemical compound with the molecular formula C10H7F3N4O2 and a molecular weight of 272.18 g/mol. IUPAC name: 3-(5-methyltetrazol-1-yl)-5-(trifluoromethyl)benzoic acid. InChIKey: XORZRGFSFQOHPN-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7F3N4O2
Molecular weight272.18 g/mol
IUPAC name3-(5-methyltetrazol-1-yl)-5-(trifluoromethyl)benzoic acid
InChIKeyXORZRGFSFQOHPN-UHFFFAOYSA-N
SMILESCC1=NN=NN1C2=CC(=CC(=C2)C(F)(F)F)C(=O)O

Computed by PubChem (NCBI)