Products 129228-55-3
CAS 129228-55-3 appears in our catalog under these names: 11–dehydro Thromboxane B3, 11-Dehydro thromboxane B3. Offered by: GLPBio, MedChemExpress. Available pack sizes: 100μg, 25μg, 50μg, Get quote.
(Z)-7-[(2R,3S,4S)-4-hydroxy-2-[(1E,5Z)-3-hydroxyocta-1,5-dienyl]-6-oxooxan-3-yl]hept-5-enoic acid (CAS 129228-55-3) is a chemical compound with the molecular formula C20H30O6 and a molecular weight of 366.4 g/mol. IUPAC name: (Z)-7-[(2R,3S,4S)-4-hydroxy-2-[(1E,5Z)-3-hydroxyocta-1,5-dienyl]-6-oxooxan-3-yl]hept-5-enoic acid. InChIKey: OAHMLWQISGEXBB-RLPQVOTCSA-N.
| Molecular formula | C20H30O6 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | (Z)-7-[(2R,3S,4S)-4-hydroxy-2-[(1E,5Z)-3-hydroxyocta-1,5-dienyl]-6-oxooxan-3-yl]hept-5-enoic acid |
| InChIKey | OAHMLWQISGEXBB-RLPQVOTCSA-N |
| SMILES | CC/C=C\CC(/C=C/[C@@H]1[C@H]([C@H](CC(=O)O1)O)C/C=C\CCCC(=O)O)O |
Computed by PubChem (NCBI)