CAS 1292282-19-9 is the registry number for (S)-4-(Oxiran-2-yl)-2,8-bis(trifluoromethyl)quinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-[(2S)-oxiran-2-yl]-2,8-bis(trifluoromethyl)quinoline (CAS 1292282-19-9) is a chemical compound with the molecular formula C13H7F6NO and a molecular weight of 307.19 g/mol. IUPAC name: 4-[(2S)-oxiran-2-yl]-2,8-bis(trifluoromethyl)quinoline. InChIKey: ZRNRGGNAVKYDQA-SECBINFHSA-N.
| Molecular formula | C13H7F6NO |
|---|---|
| Molecular weight | 307.19 g/mol |
| IUPAC name | 4-[(2S)-oxiran-2-yl]-2,8-bis(trifluoromethyl)quinoline |
| InChIKey | ZRNRGGNAVKYDQA-SECBINFHSA-N |
| SMILES | C1[C@@H](O1)C2=CC(=NC3=C2C=CC=C3C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)