CAS 1292307-04-0 is the registry number for (1S,3R)–3–Hydroxycyclopentane acetic acid methyl ester. Offered by: GLPBio. Available pack sizes: 50mg.
Methyl 2-[(1S,3R)-3-hydroxycyclopentyl]acetate (CAS 1292307-04-0) is a chemical compound with the molecular formula C8H14O3 and a molecular weight of 158.19 g/mol. IUPAC name: methyl 2-[(1S,3R)-3-hydroxycyclopentyl]acetate. InChIKey: JKYJDPCEVAGWBX-NKWVEPMBSA-N.
| Molecular formula | C8H14O3 |
|---|---|
| Molecular weight | 158.19 g/mol |
| IUPAC name | methyl 2-[(1S,3R)-3-hydroxycyclopentyl]acetate |
| InChIKey | JKYJDPCEVAGWBX-NKWVEPMBSA-N |
| SMILES | COC(=O)C[C@H]1CC[C@H](C1)O |
Computed by PubChem (NCBI)