CAS 1292307-06-2 appears in our catalog under these names: (1S,3R)-3-Hydroxycyclopentane carboxylic acid methyl ester, 97%, (1S,3R)–3–Hydroxycyclopentane carboxylic acid methyl ester, (1S,3R)-3-Hydroxycyclopentane carboxylic acid methyl ester, 97%, 97%, (1S,3R)-3-Hydroxycyclopentane carboxylic acid methyl ester. Offered by: AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5g, 10g, 50mg, 100mg, 250mg, 500mg, 1g, Get quote.
Cis-methyl (1S,3R)-3-hydroxycyclopentane-1-carboxylate (CAS 1292307-06-2) is a chemical compound with the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. IUPAC name: cis-methyl (1S,3R)-3-hydroxycyclopentane-1-carboxylate. InChIKey: ASZRODBLMORHAR-NTSWFWBYSA-N.
| Molecular formula | C7H12O3 |
|---|---|
| Molecular weight | 144.17 g/mol |
| IUPAC name | cis-methyl (1S,3R)-3-hydroxycyclopentane-1-carboxylate |
| InChIKey | ASZRODBLMORHAR-NTSWFWBYSA-N |
| SMILES | COC(=O)[C@H]1CC[C@H](C1)O |
Computed by PubChem (NCBI)