CAS 129244-66-2 appears in our catalog under these names: Hoechst 33258 analog 6, 98+%, Hoechst 33258 analog 6, Hoechst 33258 analog 6 99%, Hoechst 33258 analog 6, 99%, 99%, Hoechst 33258 analog 6, 99.21%. Offered by: AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 100mg, 5mg, 10mg, 1mg, 25mg, 50mg, 10mM/1mL, 50 mg.
2,6-ditert-butyl-4-[6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazol-2-yl]phenol (CAS 129244-66-2) is a chemical compound with the molecular formula C33H40N6O and a molecular weight of 536.7 g/mol. IUPAC name: 2,6-ditert-butyl-4-[6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazol-2-yl]phenol. InChIKey: LXRWWFIBSFWADZ-UHFFFAOYSA-N.
| Molecular formula | C33H40N6O |
|---|---|
| Molecular weight | 536.7 g/mol |
| IUPAC name | 2,6-ditert-butyl-4-[6-[6-(4-methylpiperazin-1-yl)-1H-benzimidazol-2-yl]-1H-benzimidazol-2-yl]phenol |
| InChIKey | LXRWWFIBSFWADZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)C2=NC3=C(N2)C=C(C=C3)C4=NC5=C(N4)C=C(C=C5)N6CCN(CC6)C |
Computed by PubChem (NCBI)