Products 129266-23-5
CAS 129266-23-5 is the registry number for 2-Hydroxybenzamide-D3. Offered by: TRC. Available pack sizes: 500mg.
N,N-dideuterio-2-deuteriooxybenzamide (CAS 129266-23-5) is a chemical compound with the molecular formula C7H7NO2 and a molecular weight of 140.15 g/mol. IUPAC name: N,N-dideuterio-2-deuteriooxybenzamide. InChIKey: SKZKKFZAGNVIMN-ZRLBSURWSA-N.
| Molecular formula | C7H7NO2 |
|---|---|
| Molecular weight | 140.15 g/mol |
| IUPAC name | N,N-dideuterio-2-deuteriooxybenzamide |
| InChIKey | SKZKKFZAGNVIMN-ZRLBSURWSA-N |
| SMILES | [2H]N([2H])C(=O)C1=CC=CC=C1O[2H] |
Computed by PubChem (NCBI)