CAS 1292815-71-4 is the registry number for Fenpropimorph-d3, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.
(2R,6S)-4-[2-[(4-tert-butylphenyl)methyl]-3,3,3-trideuteriopropyl]-2,6-dimethylmorpholine (CAS 1292815-71-4) is a chemical compound with the molecular formula C20H33NO and a molecular weight of 306.5 g/mol. IUPAC name: (2R,6S)-4-[2-[(4-tert-butylphenyl)methyl]-3,3,3-trideuteriopropyl]-2,6-dimethylmorpholine. InChIKey: RYAUSSKQMZRMAI-ZIDLVMCTSA-N.
| Molecular formula | C20H33NO |
|---|---|
| Molecular weight | 306.5 g/mol |
| IUPAC name | (2R,6S)-4-[2-[(4-tert-butylphenyl)methyl]-3,3,3-trideuteriopropyl]-2,6-dimethylmorpholine |
| InChIKey | RYAUSSKQMZRMAI-ZIDLVMCTSA-N |
| SMILES | [2H]C([2H])([2H])C(CC1=CC=C(C=C1)C(C)(C)C)CN2C[C@H](O[C@H](C2)C)C |
Computed by PubChem (NCBI)