CAS 129283-82-5 appears in our catalog under these names: Bis(4-methacryloylthiophenyl) sulfide, 97%, S,S'–(Thiobis(4,1–phenylene)) bis(2–methylprop–2–enethioate), Bis(4-methacryloylthiophenyl) Sulfide, >97.0%(HPLC), Bis(4-methacryloylthiophenyl) Sulfide, 98%, 98%, BIS(4-METHACRYLOYLTHIOPHENYL) SULFIDE, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 250mg, 100mg.
S-[4-[4-(2-methylprop-2-enoylsulfanyl)phenyl]sulfanylphenyl] 2-methylprop-2-enethioate (CAS 129283-82-5) is a chemical compound with the molecular formula C20H18O2S3 and a molecular weight of 386.6 g/mol. IUPAC name: S-[4-[4-(2-methylprop-2-enoylsulfanyl)phenyl]sulfanylphenyl] 2-methylprop-2-enethioate. InChIKey: SPNAQSNLZHHUIJ-UHFFFAOYSA-N.
| Molecular formula | C20H18O2S3 |
|---|---|
| Molecular weight | 386.6 g/mol |
| IUPAC name | S-[4-[4-(2-methylprop-2-enoylsulfanyl)phenyl]sulfanylphenyl] 2-methylprop-2-enethioate |
| InChIKey | SPNAQSNLZHHUIJ-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)SC1=CC=C(C=C1)SC2=CC=C(C=C2)SC(=O)C(=C)C |
Computed by PubChem (NCBI)