CAS 1292836-20-4 appears in our catalog under these names: Pibrentasvir Impurity 4, (1S,4S)-1,4-Bis(4-chloro-2-fluoro-5-nitrophenyl)butane-1,4-diol. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
(1S,4S)-1,4-bis(4-chloro-2-fluoro-5-nitrophenyl)butane-1,4-diol (CAS 1292836-20-4) is a chemical compound with the molecular formula C16H12Cl2F2N2O6 and a molecular weight of 437.2 g/mol. IUPAC name: (1S,4S)-1,4-bis(4-chloro-2-fluoro-5-nitrophenyl)butane-1,4-diol. InChIKey: CAXZNRBDCSSKBX-HOTGVXAUSA-N.
| Molecular formula | C16H12Cl2F2N2O6 |
|---|---|
| Molecular weight | 437.2 g/mol |
| IUPAC name | (1S,4S)-1,4-bis(4-chloro-2-fluoro-5-nitrophenyl)butane-1,4-diol |
| InChIKey | CAXZNRBDCSSKBX-HOTGVXAUSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])Cl)F)[C@H](CC[C@@H](C2=CC(=C(C=C2F)Cl)[N+](=O)[O-])O)O |
Computed by PubChem (NCBI)