CAS 1293-67-0 appears in our catalog under these names: 1,1'-Dichloroferrocene, 98%, 1,1'-Dichloroferrocene, 1,1'-Dichloroferrocene 98%. Offered by: Chemat Brand, Biosynth, Ambeed. Available pack sizes: on request, 1000mg, 2000mg, 5000mg, 10000mg, 25000mg, 250mg, 1g.
Bis(1-chlorocyclopenta-1,3-diene);iron (CAS 1293-67-0) is a chemical compound with the molecular formula C10H8Cl2Fe-2 and a molecular weight of 254.92 g/mol. IUPAC name: bis(1-chlorocyclopenta-1,3-diene);iron. InChIKey: KJSUIDLHFPCTQK-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2Fe-2 |
|---|---|
| Molecular weight | 254.92 g/mol |
| IUPAC name | bis(1-chlorocyclopenta-1,3-diene);iron |
| InChIKey | KJSUIDLHFPCTQK-UHFFFAOYSA-N |
| SMILES | [CH-]1C=CC=C1Cl.[CH-]1C=CC=C1Cl.[Fe] |
Computed by PubChem (NCBI)