CAS 1293000-27-7 is the registry number for 3-(2,4-Dichloro-5-fluorophenyl)-1H-pyrazole-4-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-(2,4-dichloro-5-fluorophenyl)-1H-pyrazole-4-sulfonyl chloride (CAS 1293000-27-7) is a chemical compound with the molecular formula C9H4Cl3FN2O2S and a molecular weight of 329.6 g/mol. IUPAC name: 5-(2,4-dichloro-5-fluorophenyl)-1H-pyrazole-4-sulfonyl chloride. InChIKey: GPDOVQVGLDDSES-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl3FN2O2S |
|---|---|
| Molecular weight | 329.6 g/mol |
| IUPAC name | 5-(2,4-dichloro-5-fluorophenyl)-1H-pyrazole-4-sulfonyl chloride |
| InChIKey | GPDOVQVGLDDSES-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Cl)Cl)C2=C(C=NN2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)