CAS 129301-42-4 appears in our catalog under these names: Fluorinated triethylene glycol, 95%, 2,2'-((Perfluoroethane-1,2-diyl)bis(oxy))bis(2,2-difluoroethanol) 98%, 2,2'-((Perfluoroethane-1,2-diyl)bis(oxy))bis(2,2-difluoroethanol), 98%, 98%, Fluorinated triethylene glycol, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 250mg, 100g.
2-[2-(1,1-difluoro-2-hydroxyethoxy)-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethanol (CAS 129301-42-4) is a chemical compound with the molecular formula C6H6F8O4 and a molecular weight of 294.10 g/mol. IUPAC name: 2-[2-(1,1-difluoro-2-hydroxyethoxy)-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethanol. InChIKey: CWIAFBQLWOMNFY-UHFFFAOYSA-N.
| Molecular formula | C6H6F8O4 |
|---|---|
| Molecular weight | 294.10 g/mol |
| IUPAC name | 2-[2-(1,1-difluoro-2-hydroxyethoxy)-1,1,2,2-tetrafluoroethoxy]-2,2-difluoroethanol |
| InChIKey | CWIAFBQLWOMNFY-UHFFFAOYSA-N |
| SMILES | C(C(OC(C(OC(CO)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)