CAS 129332-29-2 appears in our catalog under these names: tert-Butyl Fluvastatin, >95% (HPLC), 1,1-Dimethylethyl (3RS,5SR,6E)-7-(3-(4-Fluorophenyl)-1-(1-methylethyl)-1H-indol-2-yl)-3,5-dihydroxyhept-6-enoate (Fluvastatin tert-Butyl Ester), Fluvastatin EP Impurity B (as Racemate). Offered by: TRC, Mikromol. Available pack sizes: 10mg, 250mg, 4x25mg, 25mg.
Tert-butyl (E)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate (CAS 129332-29-2) is a chemical compound with the molecular formula C28H34FNO4 and a molecular weight of 467.6 g/mol. IUPAC name: tert-butyl (E)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate. InChIKey: USGKHYXJISAYPE-CCEZHUSRSA-N.
| Molecular formula | C28H34FNO4 |
|---|---|
| Molecular weight | 467.6 g/mol |
| IUPAC name | tert-butyl (E)-7-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]-3,5-dihydroxyhept-6-enoate |
| InChIKey | USGKHYXJISAYPE-CCEZHUSRSA-N |
| SMILES | CC(C)N1C2=CC=CC=C2C(=C1/C=C/C(CC(CC(=O)OC(C)(C)C)O)O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)