CAS 129332-30-5 appears in our catalog under these names: (E)-3-[3'-(4''-Fluorophenyl)-1'-(1''-methylethyl)-1h-indol-2''-yl]-2-propnal, 95%, 3-(3-(4-Fluorophenyl)-1-isopropyl-1H-indol-2-yl)acrylaldehyde, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 100g, 5g, 25g, 1g.
(E)-3-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]prop-2-enal (CAS 129332-30-5) is a chemical compound with the molecular formula C20H18FNO and a molecular weight of 307.4 g/mol. IUPAC name: (E)-3-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]prop-2-enal. InChIKey: DVWHSTKQJBIYCK-VMPITWQZSA-N.
| Molecular formula | C20H18FNO |
|---|---|
| Molecular weight | 307.4 g/mol |
| IUPAC name | (E)-3-[3-(4-fluorophenyl)-1-propan-2-ylindol-2-yl]prop-2-enal |
| InChIKey | DVWHSTKQJBIYCK-VMPITWQZSA-N |
| SMILES | CC(C)N1C2=CC=CC=C2C(=C1/C=C/C=O)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)