CAS 1294001-06-1 is the registry number for (R)-4-(2-Chloro-2,2-difluoroethyl)-1-(chloromethyl)pyrrolidin-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4R)-4-(2-chloro-2,2-difluoroethyl)-1-(chloromethyl)pyrrolidin-2-one (CAS 1294001-06-1) is a chemical compound with the molecular formula C7H9Cl2F2NO and a molecular weight of 232.05 g/mol. IUPAC name: (4R)-4-(2-chloro-2,2-difluoroethyl)-1-(chloromethyl)pyrrolidin-2-one. InChIKey: CGMARLLZXBODJX-RXMQYKEDSA-N.
| Molecular formula | C7H9Cl2F2NO |
|---|---|
| Molecular weight | 232.05 g/mol |
| IUPAC name | (4R)-4-(2-chloro-2,2-difluoroethyl)-1-(chloromethyl)pyrrolidin-2-one |
| InChIKey | CGMARLLZXBODJX-RXMQYKEDSA-N |
| SMILES | C1[C@@H](CN(C1=O)CCl)CC(F)(F)Cl |
Computed by PubChem (NCBI)