CAS 1294450-46-6 is the registry number for 3,4-Dihydroxymethamphetamine-3-O-sulfate. Offered by: TRC. Available pack sizes: 100mg.
[2-hydroxy-5-[2-(methylamino)propyl]phenyl] hydrogen sulfate (CAS 1294450-46-6) is a chemical compound with the molecular formula C10H15NO5S and a molecular weight of 261.30 g/mol. IUPAC name: [2-hydroxy-5-[2-(methylamino)propyl]phenyl] hydrogen sulfate. InChIKey: UGAZAKOOSVDNNT-UHFFFAOYSA-N.
| Molecular formula | C10H15NO5S |
|---|---|
| Molecular weight | 261.30 g/mol |
| IUPAC name | [2-hydroxy-5-[2-(methylamino)propyl]phenyl] hydrogen sulfate |
| InChIKey | UGAZAKOOSVDNNT-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC(=C(C=C1)O)OS(=O)(=O)O)NC |
Computed by PubChem (NCBI)