CAS 1294452-11-1 is the registry number for D-Glucosamine sulphate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 100g, 5g, 1g.
(3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;sulfuric acid (CAS 1294452-11-1) is a chemical compound with the molecular formula C6H15NO9S and a molecular weight of 277.25 g/mol. IUPAC name: (3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;sulfuric acid. InChIKey: VSKBNXJTZZAEPH-NSEZLWDYSA-N.
| Molecular formula | C6H15NO9S |
|---|---|
| Molecular weight | 277.25 g/mol |
| IUPAC name | (3R,4R,5S,6R)-3-amino-6-(hydroxymethyl)oxane-2,4,5-triol;sulfuric acid |
| InChIKey | VSKBNXJTZZAEPH-NSEZLWDYSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H](C(O1)O)N)O)O)O.OS(=O)(=O)O |
Computed by PubChem (NCBI)