CAS 1294519-40-6 appears in our catalog under these names: (R)-1-(5-(2,2,2-Trifluoroethoxy)pyridin-2-yl)ethanamine hydrochloride, 95%, 95%, (R)-1-(5-(2,2,2-Trifluoroethoxy)pyridin-2-yl)ethanamine hydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
(1R)-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethanamine;hydrochloride (CAS 1294519-40-6) is a chemical compound with the molecular formula C9H12ClF3N2O and a molecular weight of 256.65 g/mol. IUPAC name: (1R)-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethanamine;hydrochloride. InChIKey: HBLPXYBXTAMRKT-FYZOBXCZSA-N.
| Molecular formula | C9H12ClF3N2O |
|---|---|
| Molecular weight | 256.65 g/mol |
| IUPAC name | (1R)-1-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]ethanamine;hydrochloride |
| InChIKey | HBLPXYBXTAMRKT-FYZOBXCZSA-N |
| SMILES | C[C@H](C1=NC=C(C=C1)OCC(F)(F)F)N.Cl |
Computed by PubChem (NCBI)