CAS 1295300-15-0 is the registry number for 8-Bromo-5-hydroxy-6,7-dimethoxy-2-methyl-4H-chromen-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
8-bromo-5-hydroxy-6,7-dimethoxy-2-methylchromen-4-one (CAS 1295300-15-0) is a chemical compound with the molecular formula C12H11BrO5 and a molecular weight of 315.12 g/mol. IUPAC name: 8-bromo-5-hydroxy-6,7-dimethoxy-2-methylchromen-4-one. InChIKey: PPAFBIBPQDYPCF-UHFFFAOYSA-N.
| Molecular formula | C12H11BrO5 |
|---|---|
| Molecular weight | 315.12 g/mol |
| IUPAC name | 8-bromo-5-hydroxy-6,7-dimethoxy-2-methylchromen-4-one |
| InChIKey | PPAFBIBPQDYPCF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C2=C(C(=C(C(=C2O1)Br)OC)OC)O |
Computed by PubChem (NCBI)