CAS 129541-43-1 appears in our catalog under these names: 5-Bromo-4-chloro-3-indolyl butyrate, 95%, 5-Bromo-4-chloro-3-indoxyl butyrate, 5-Bromo-4-chloro-1H-indol-3-yl butyrate 98%, 5-BROMO-4-CHLORO-3-INDOLYL BUTYRATE, 5-Bromo-4-chloro-3-indolyl butyrate, 98%, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 250mg, 1g, 100mg, 10g, 2g, 5g, 25g, 5MG.
(5-bromo-4-chloro-1H-indol-3-yl) butanoate (CAS 129541-43-1) is a chemical compound with the molecular formula C12H11BrClNO2 and a molecular weight of 316.58 g/mol. IUPAC name: (5-bromo-4-chloro-1H-indol-3-yl) butanoate. InChIKey: UKTKOBRRRRODGL-UHFFFAOYSA-N.
| Molecular formula | C12H11BrClNO2 |
|---|---|
| Molecular weight | 316.58 g/mol |
| IUPAC name | (5-bromo-4-chloro-1H-indol-3-yl) butanoate |
| InChIKey | UKTKOBRRRRODGL-UHFFFAOYSA-N |
| SMILES | CCCC(=O)OC1=CNC2=C1C(=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)