CAS 129612-87-9 is the registry number for Miproxifene. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg.
4-[(Z)-1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-(4-propan-2-ylphenyl)but-1-enyl]phenol (CAS 129612-87-9) is a chemical compound with the molecular formula C29H35NO2 and a molecular weight of 429.6 g/mol. IUPAC name: 4-[(Z)-1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-(4-propan-2-ylphenyl)but-1-enyl]phenol. InChIKey: FVVPWVFWOOMXEZ-ZIADKAODSA-N.
| Molecular formula | C29H35NO2 |
|---|---|
| Molecular weight | 429.6 g/mol |
| IUPAC name | 4-[(Z)-1-[4-[2-(dimethylamino)ethoxy]phenyl]-2-(4-propan-2-ylphenyl)but-1-enyl]phenol |
| InChIKey | FVVPWVFWOOMXEZ-ZIADKAODSA-N |
| SMILES | CC/C(=C(\C1=CC=C(C=C1)O)/C2=CC=C(C=C2)OCCN(C)C)/C3=CC=C(C=C3)C(C)C |
Computed by PubChem (NCBI)