CAS 1296223-96-5 is the registry number for 6-Bromo-8-iodo-imidazo[1,2-a]pyridine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
6-bromo-8-iodoimidazo[1,2-a]pyridine-2-carboxylic acid (CAS 1296223-96-5) is a chemical compound with the molecular formula C8H4BrIN2O2 and a molecular weight of 366.94 g/mol. IUPAC name: 6-bromo-8-iodoimidazo[1,2-a]pyridine-2-carboxylic acid. InChIKey: DFPQZPHSPLHPFK-UHFFFAOYSA-N.
| Molecular formula | C8H4BrIN2O2 |
|---|---|
| Molecular weight | 366.94 g/mol |
| IUPAC name | 6-bromo-8-iodoimidazo[1,2-a]pyridine-2-carboxylic acid |
| InChIKey | DFPQZPHSPLHPFK-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NC(=CN2C=C1Br)C(=O)O)I |
Computed by PubChem (NCBI)