CAS 1296939-25-7 appears in our catalog under these names: 2-(4-Bromophenyl)-2,3-dihydrobenzo[d][1,3,2]diazaborinin-4(1H)-one, 97%, 97%, 2-(4-Bromophenyl)-2,3-dihydrobenzo[d][1,3,2]diazaborinin-4(1H)-one, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2-(4-bromophenyl)-1,3-dihydro-1,3,2-benzodiazaborinin-4-one (CAS 1296939-25-7) is a chemical compound with the molecular formula C13H10BBrN2O and a molecular weight of 300.95 g/mol. IUPAC name: 2-(4-bromophenyl)-1,3-dihydro-1,3,2-benzodiazaborinin-4-one. InChIKey: KZNDICYULQUWIW-UHFFFAOYSA-N.
| Molecular formula | C13H10BBrN2O |
|---|---|
| Molecular weight | 300.95 g/mol |
| IUPAC name | 2-(4-bromophenyl)-1,3-dihydro-1,3,2-benzodiazaborinin-4-one |
| InChIKey | KZNDICYULQUWIW-UHFFFAOYSA-N |
| SMILES | B1(NC2=CC=CC=C2C(=O)N1)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)