CAS 129700-41-0 appears in our catalog under these names: Atovaquone EP Impurity D, Rel-2-((1r,4r)-4-(4-chlorophenyl)cyclohexyl)-3-methoxynaphthalene-1,4-dione, 95%, Atovaquone Impurity 4(Atovaquone EP Impurity D), O-Methyl Atovaquone, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[4-(4-chlorophenyl)cyclohexyl]-3-methoxynaphthalene-1,4-dione (CAS 129700-41-0) is a chemical compound with the molecular formula C23H21ClO3 and a molecular weight of 380.9 g/mol. IUPAC name: 2-[4-(4-chlorophenyl)cyclohexyl]-3-methoxynaphthalene-1,4-dione. InChIKey: LHZIOFDLSVYSFT-UHFFFAOYSA-N.
| Molecular formula | C23H21ClO3 |
|---|---|
| Molecular weight | 380.9 g/mol |
| IUPAC name | 2-[4-(4-chlorophenyl)cyclohexyl]-3-methoxynaphthalene-1,4-dione |
| InChIKey | LHZIOFDLSVYSFT-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=O)C2=CC=CC=C2C1=O)C3CCC(CC3)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)