Products 129700-44-3
CAS 129700-44-3 is the registry number for Ac-Atovaquone. Offered by: MedChemExpress. Available pack sizes: Get quote.
[3-[4-(4-chlorophenyl)cyclohexyl]-1,4-dioxonaphthalen-2-yl] acetate (CAS 129700-44-3) is a chemical compound with the molecular formula C24H21ClO4 and a molecular weight of 408.9 g/mol. IUPAC name: [3-[4-(4-chlorophenyl)cyclohexyl]-1,4-dioxonaphthalen-2-yl] acetate. InChIKey: SQMKZWUACDCBHB-UHFFFAOYSA-N.
| Molecular formula | C24H21ClO4 |
|---|---|
| Molecular weight | 408.9 g/mol |
| IUPAC name | [3-[4-(4-chlorophenyl)cyclohexyl]-1,4-dioxonaphthalen-2-yl] acetate |
| InChIKey | SQMKZWUACDCBHB-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C(=O)C2=CC=CC=C2C1=O)C3CCC(CC3)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)