CAS 1297537-33-7 appears in our catalog under these names: Darolutamide Impurity 2, ORM-15341, >95% (HPLC), ORM-15341/ 98.61% (existing batch purity), ORM–15341, ORM-15341. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 100mg, 10mg, 50mg, 1mg, 5mg, 25mg, 10mM (in 1ml dmso).
3-acetyl-N-[(2S)-1-[3-(3-chloro-4-cyanophenyl)pyrazol-1-yl]propan-2-yl]-1H-pyrazole-5-carboxamide (CAS 1297537-33-7) is a chemical compound with the molecular formula C19H17ClN6O2 and a molecular weight of 396.8 g/mol. IUPAC name: 3-acetyl-N-[(2S)-1-[3-(3-chloro-4-cyanophenyl)pyrazol-1-yl]propan-2-yl]-1H-pyrazole-5-carboxamide. InChIKey: GMBPVBVTPBWIKC-NSHDSACASA-N.
| Molecular formula | C19H17ClN6O2 |
|---|---|
| Molecular weight | 396.8 g/mol |
| IUPAC name | 3-acetyl-N-[(2S)-1-[3-(3-chloro-4-cyanophenyl)pyrazol-1-yl]propan-2-yl]-1H-pyrazole-5-carboxamide |
| InChIKey | GMBPVBVTPBWIKC-NSHDSACASA-N |
| SMILES | C[C@@H](CN1C=CC(=N1)C2=CC(=C(C=C2)C#N)Cl)NC(=O)C3=CC(=NN3)C(=O)C |
Computed by PubChem (NCBI)