CAS 1297549-70-2 is the registry number for Ethyl (R)-4,4,4-trifluoro-3-methylbutanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (3R)-4,4,4-trifluoro-3-methylbutanoate (CAS 1297549-70-2) is a chemical compound with the molecular formula C7H11F3O2 and a molecular weight of 184.16 g/mol. IUPAC name: ethyl (3R)-4,4,4-trifluoro-3-methylbutanoate. InChIKey: SRVTXLPAWBTQSA-RXMQYKEDSA-N.
| Molecular formula | C7H11F3O2 |
|---|---|
| Molecular weight | 184.16 g/mol |
| IUPAC name | ethyl (3R)-4,4,4-trifluoro-3-methylbutanoate |
| InChIKey | SRVTXLPAWBTQSA-RXMQYKEDSA-N |
| SMILES | CCOC(=O)C[C@@H](C)C(F)(F)F |
Computed by PubChem (NCBI)