CAS 129769-09-1 is the registry number for 3,3-Dichloro-5,5-dimethylazepan-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg.
3,3-dichloro-5,5-dimethylazepan-2-one (CAS 129769-09-1) is a chemical compound with the molecular formula C8H13Cl2NO and a molecular weight of 210.10 g/mol. IUPAC name: 3,3-dichloro-5,5-dimethylazepan-2-one. InChIKey: TTZKHMJRCOJTDF-UHFFFAOYSA-N.
| Molecular formula | C8H13Cl2NO |
|---|---|
| Molecular weight | 210.10 g/mol |
| IUPAC name | 3,3-dichloro-5,5-dimethylazepan-2-one |
| InChIKey | TTZKHMJRCOJTDF-UHFFFAOYSA-N |
| SMILES | CC1(CCNC(=O)C(C1)(Cl)Cl)C |
Computed by PubChem (NCBI)