CAS 129794-24-7 is the registry number for KCA 098. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, Get quote.
[9-(dimethylcarbamoyloxy)-6-oxo-5H-[1]benzofuro[3,2-c]quinolin-3-yl] N,N-dimethylcarbamate (CAS 129794-24-7) is a chemical compound with the molecular formula C21H19N3O6 and a molecular weight of 409.4 g/mol. IUPAC name: [9-(dimethylcarbamoyloxy)-6-oxo-5H-[1]benzofuro[3,2-c]quinolin-3-yl] N,N-dimethylcarbamate. InChIKey: IHQFYMAOIYJTBA-UHFFFAOYSA-N.
| Molecular formula | C21H19N3O6 |
|---|---|
| Molecular weight | 409.4 g/mol |
| IUPAC name | [9-(dimethylcarbamoyloxy)-6-oxo-5H-[1]benzofuro[3,2-c]quinolin-3-yl] N,N-dimethylcarbamate |
| InChIKey | IHQFYMAOIYJTBA-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)OC1=CC2=C(C=C1)C3=C(C4=C(O3)C=C(C=C4)OC(=O)N(C)C)C(=O)N2 |
Computed by PubChem (NCBI)