CAS 1298116-18-3 is the registry number for Monacolin L Acid Lithium Salt. Offered by: TRC. Available pack sizes: 50mg.
CAS 1298116-18-3 identifies a chemical compound with the molecular formula C19H30LiO4 and a molecular weight of 329.4 g/mol. InChIKey: QHKKKDDIHVSMIS-NCJNBGFMSA-N.
| Molecular formula | C19H30LiO4 |
|---|---|
| Molecular weight | 329.4 g/mol |
| InChIKey | QHKKKDDIHVSMIS-NCJNBGFMSA-N |
| SMILES | [Li].C[C@@H]1CC[C@@H]2[C@H]([C@H](C=CC2=C1)C)CC[C@H](C[C@H](CC(=O)O)O)O |
Computed by PubChem (NCBI)