Products 129829-03-4
CAS 129829-03-4 is the registry number for BMS-180431. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3R,5S,6E)-9,9-bis(4-fluorophenyl)-3,5-dihydroxy-8-(1-methyltetrazol-5-yl)nona-6,8-dienoic acid (CAS 129829-03-4) is a chemical compound with the molecular formula C23H22F2N4O4 and a molecular weight of 456.4 g/mol. IUPAC name: (3R,5S,6E)-9,9-bis(4-fluorophenyl)-3,5-dihydroxy-8-(1-methyltetrazol-5-yl)nona-6,8-dienoic acid. InChIKey: HPFIYXJJZZWEPC-MMKWGKFASA-N.
| Molecular formula | C23H22F2N4O4 |
|---|---|
| Molecular weight | 456.4 g/mol |
| IUPAC name | (3R,5S,6E)-9,9-bis(4-fluorophenyl)-3,5-dihydroxy-8-(1-methyltetrazol-5-yl)nona-6,8-dienoic acid |
| InChIKey | HPFIYXJJZZWEPC-MMKWGKFASA-N |
| SMILES | CN1C(=NN=N1)C(=C(C2=CC=C(C=C2)F)C3=CC=C(C=C3)F)/C=C/[C@H](C[C@H](CC(=O)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
(+)-Bmy-21950 free acid