Products 129832-03-7
CAS 129832-03-7 appears in our catalog under these names: Inositol hexaphosphoric acid dipotassium salt, 98%, Phytic acid potassium, Phytic acid potassium, Phytic acid dipotassium salt, 80.00%, Phytic acid potassium 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Chemat, Ambeed. Available pack sizes: 100g, 1kg, 500g, 25g, 5g, 1g, 500mg, 10g.
Dipotassium;[(2R,3S,5R,6R)-2,3,4,5,6-pentaphosphonooxycyclohexyl] phosphate (CAS 129832-03-7) is a chemical compound with the molecular formula C6H16K2O24P6 and a molecular weight of 736.22 g/mol. IUPAC name: dipotassium;[(2R,3S,5R,6R)-2,3,4,5,6-pentaphosphonooxycyclohexyl] phosphate. InChIKey: LFTTXUFEVNNTHA-OKBOCSEJSA-L.
| Molecular formula | C6H16K2O24P6 |
|---|---|
| Molecular weight | 736.22 g/mol |
| IUPAC name | dipotassium;[(2R,3S,5R,6R)-2,3,4,5,6-pentaphosphonooxycyclohexyl] phosphate |
| InChIKey | LFTTXUFEVNNTHA-OKBOCSEJSA-L |
| SMILES | [C@H]1([C@@H](C([C@H]([C@@H](C1OP(=O)(O)O)OP(=O)(O)O)OP(=O)(O)O)OP(=O)([O-])[O-])OP(=O)(O)O)OP(=O)(O)O.[K+].[K+] |
Computed by PubChem (NCBI)
Synonyms:
Phytic acid dipotassium salt, PHYTIC ACID DIPOTASSIUM, Phytic acid (potassium), dipotassium;[(2R,3R,5S,6R)-2,3,4,5,6-pentaphosphonooxycyclohexyl] phosphate, INOSITOL HEXAPHOSPHORIC ACID DIPOTASSIUM SALT, dipotassium;[(2R,3S,5R,6R)-2,3,4,5,6-pentaphosphonooxycyclohexyl] phosphate, orb1221254