CAS 129833-31-4 appears in our catalog under these names: 2-Iodo-3,4-dimethylbenzoic acid, 95%, 2–Iodo–3,4–dimethylbenzoic acid, 2-Iodo-3,4-dimethylbenzoic acid, 97%, 97%, 3,4-Dimethyl-2-iodobenzoic acid, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 5g, 1g, 25g, 10g.
2-iodo-3,4-dimethylbenzoic acid (CAS 129833-31-4) is a chemical compound with the molecular formula C9H9IO2 and a molecular weight of 276.07 g/mol. IUPAC name: 2-iodo-3,4-dimethylbenzoic acid. InChIKey: IWMDAMFUDTUSOD-UHFFFAOYSA-N.
| Molecular formula | C9H9IO2 |
|---|---|
| Molecular weight | 276.07 g/mol |
| IUPAC name | 2-iodo-3,4-dimethylbenzoic acid |
| InChIKey | IWMDAMFUDTUSOD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C(=O)O)I)C |
Computed by PubChem (NCBI)