CAS 129848-93-7 is the registry number for L-1,2,3,4-Tetrahydronorharman-3-carboxylic acid ethyl ester hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g.
Ethyl (3S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate;hydrochloride (CAS 129848-93-7) is a chemical compound with the molecular formula C14H17ClN2O2 and a molecular weight of 280.75 g/mol. IUPAC name: ethyl (3S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate;hydrochloride. InChIKey: RAARNKBGEZGYMA-YDALLXLXSA-N.
| Molecular formula | C14H17ClN2O2 |
|---|---|
| Molecular weight | 280.75 g/mol |
| IUPAC name | ethyl (3S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate;hydrochloride |
| InChIKey | RAARNKBGEZGYMA-YDALLXLXSA-N |
| SMILES | CCOC(=O)[C@@H]1CC2=C(CN1)NC3=CC=CC=C23.Cl |
Computed by PubChem (NCBI)