CAS 129895-88-1 is the registry number for 2-Amino-1,9-dihydro-9-((1R,4S)-4-((phosphonooxy)methyl)-2-cyclopenten-1-yl)-6H-purin-6-one. Offered by: TRC. Available pack sizes: 10mg, 2,5mg, 5mg.
Carbovir monophosphate is the organic phosphate that is the 5'-monophosphate of ()-carbovir. It is functionally related to a (-)-carbovir. It is a conjugate acid of a carbovir monophosphate(2-).
Source: ChEBI
| Molecular formula | C11H14N5O5P |
|---|---|
| Molecular weight | 327.23 g/mol |
| IUPAC name | [(1S,4R)-4-(2-amino-6-oxo-1H-purin-9-yl)cyclopent-2-en-1-yl]methyl dihydrogen phosphate |
| InChIKey | OJDRNVIJFVCXOM-RQJHMYQMSA-N |
| SMILES | C1[C@@H](C=C[C@@H]1N2C=NC3=C2N=C(NC3=O)N)COP(=O)(O)O |
Computed by PubChem (NCBI)